- 2-Bromo-3-fluorotoluene
-
- $0.00 / 1g
-
2026-02-02
- CAS:59907-13-0
- Min. Order: 50mg
- Purity: 99%HPLC
- Supply Ability: 2000tons
- 2-BROMO-3-FLUOROTOLUENE
-
- $100.00 / 1kg
-
2024-04-28
- CAS:59907-13-0
- Min. Order: 1kg
- Purity: 99.93%
- Supply Ability: 1000kg per week
|
| | 2-BROMO-3-FLUOROTOLUENE Basic information |
| | 2-BROMO-3-FLUOROTOLUENE Chemical Properties |
| Melting point | 118-123℃ | | Boiling point | 187°C | | density | 1.503 | | refractive index | 1.5330 | | Fp | 76°(169°F) | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H6BrF/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3 | | InChIKey | FYCXRRYRNRDSRM-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(C)=C1Br | | CAS DataBase Reference | 59907-13-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 2-BROMO-3-FLUOROTOLUENE Usage And Synthesis |
| Uses | 2-Bromo-3-fluorotoluene is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | 2-BROMO-3-FLUOROTOLUENE Preparation Products And Raw materials |
|