|
|
| | PEAK E Chemical Properties |
| Melting point | >210°C (dec.) | | Boiling point | 718.5±60.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | Aqueous Base (Slightly) | | pka | 1.95±0.10(Predicted) | | form | solid | | color | Pale Beige to Brown | | Stability: | Decomposes under acidic condition, Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChIKey | DETVQFQGSVEQBH-PMACEKPBSA-N | | SMILES | C(N1C2=C(C(=C1)C[C@@H](C(O)=O)N)C=CC=C2)(N1C2=C(C(=C1)C[C@@H](C(O)=O)N)C=CC=C2)C |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids |
| | PEAK E Usage And Synthesis |
| Uses | 1,1’-Ethylidenebis[L-tryptophan] is a L-tryptophan (T947210) contaminant found in the peripheral blood mononuclear cells from patients with functional somatic syndromes. |
| | PEAK E Preparation Products And Raw materials |
|