|
|
| | 2-AMINO-4-METHYLBENZOPHENONE Basic information |
| | 2-AMINO-4-METHYLBENZOPHENONE Chemical Properties |
| Melting point | 65-66 °C (lit.) | | Boiling point | 407.1±33.0 °C(Predicted) | | density | 1.135±0.06 g/cm3(Predicted) | | pka | 0.82±0.10(Predicted) | | InChI | 1S/C14H13NO/c1-10-7-8-12(13(15)9-10)14(16)11-5-3-2-4-6-11/h2-9H,15H2,1H3 | | InChIKey | YINYAGBOKBLJHY-UHFFFAOYSA-N | | SMILES | Cc1ccc(c(N)c1)C(=O)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-AMINO-4-METHYLBENZOPHENONE Usage And Synthesis |
| Uses | 2-Amino-4-methylbenzophenone has been used as starting reagent in the synthesis of:
- 4-phenyl-7-methyl-2-(2′-pyridyl)quinoline and 4-phenyl-7-methyl-2-[2′-(6′-methyl)pyridyl]-quinoline
- N-tert-butyl-2-{3(R)-[3-(3-chlorophenyl)ureido]-8-methyl-2-oxo-5(R)-phenyl-1,3,4,5-tetrahydrobenz[b]azepin-1-yl}acetamide
|
| | 2-AMINO-4-METHYLBENZOPHENONE Preparation Products And Raw materials |
|