|
|
| | 4-(Difluoromethoxy)nitrobenzene Basic information |
| | 4-(Difluoromethoxy)nitrobenzene Chemical Properties |
| Melting point | 37-40 °C (lit.) | | Boiling point | 108 °C | | density | 1.384±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | powder to lump | | color | Light yellow to Brown to Dark green | | FreezingPoint | 31.0 to 34.0 ℃ | | InChI | 1S/C7H5F2NO3/c8-7(9)13-6-3-1-5(2-4-6)10(11)12/h1-4,7H | | InChIKey | SVGGBARCOQPYMV-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(OC(F)F)cc1 | | CAS DataBase Reference | 1544-86-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | RIDADR | 3276 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29049090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Difluoromethoxy)nitrobenzene Usage And Synthesis |
| Chemical Properties | Pale Yellow Crystal. | | Uses | 4-(Difluoromethoxy)nitrobenzene is an industrial chemical that can be used to make 4-fluoro-3-pyridinol (F3P), a compound that has potential as a new drug for the treatment of cancer. The synthesis of F3P begins with the reaction of 4-(difluoromethoxy)nitrobenzene and potassium hydroxide in methanol, which yields 4-fluoro-3-hydroxypyridine. This product is then reacted with ammonia gas and pyridine to yield F3P. The final step involves heating the product at high temperature with nitric acid, which yields nitrobenztriazole. | | General Description | 4-(Difluoromethoxy)nitrobenzene (1-(difluoromethoxy)-4-nitrobenzene) can be synthesized by reacting 4-nitrophenol with KOH, water and methanol. |
| | 4-(Difluoromethoxy)nitrobenzene Preparation Products And Raw materials |
|