| Company Name: |
INTATRADE GmbH
|
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Products Intro: |
Product Name:2,5-Di-tert-butyl-4-hydroxyanisole
CAS:1991-52-2
Remarks:IS05880
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:2,5-Di-tert-butyl-4-Methoxyphenol, 97%
CAS:1991-52-2
Package:5g Remarks:H35053
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2,5-Di-tert-butyl-4-Methoxyphenol
CAS:1991-52-2
Purity:97% Package:25G,5G
|
| Company Name: |
Nanjing Chemlin Chemical Co., Ltd
|
| Tel: |
025-83697070 13913916777; |
| Email: |
info@chemlin.com.cn |
| Products Intro: |
Product Name:2,5-Di-tert-Butyl-4-methoxy-phenol
CAS:1991-52-2
Purity:0.98 Package:5KG; 1KG
|
|
| | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE Basic information |
| Product Name: | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE | | Synonyms: | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE;2,5-DI-TERT-BUTYL-4-METHOXYPHENOL;2,5-DI-TERT-BUTYL-HYDROXYANISOLE;2,5- Di-tert-butyl 4-hydroxyanizole;2,5-Di-tert-butyl-4-methoxyphenol 97%;Phenol, 2,5-bis(1,1-dimethylethyl)-4-methoxy-;2,5-Di-tert-butyl-4-methoxyphenol | | CAS: | 1991-52-2 | | MF: | C15H24O2 | | MW: | 236.35 | | EINECS: | 217-873-0 | | Product Categories: | Building Blocks;C9 to C20+;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Phenols | | Mol File: | 1991-52-2.mol |  |
| | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE Chemical Properties |
| Melting point | 99-102 °C (lit.) | | Boiling point | 337.8±42.0 °C(Predicted) | | density | 0.963±0.06 g/cm3(Predicted) | | form | Crystalline Powder | | pka | 11.97±0.23(Predicted) | | color | White to cream | | InChI | 1S/C15H24O2/c1-14(2,3)10-9-13(17-7)11(8-12(10)16)15(4,5)6/h8-9,16H,1-7H3 | | InChIKey | FLLRQABPKFCXSO-UHFFFAOYSA-N | | SMILES | COc1cc(c(O)cc1C(C)(C)C)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE Usage And Synthesis |
| Uses | 2,5-Di-tert-butyl-4-methoxyphenol is used as a non-tumorigenic compound in contrast to DBHQ. | | Definition | ChEBI: 2,5-ditert-butyl-4-methoxyphenol is a member of phenols and a member of methoxybenzenes. |
| | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE Preparation Products And Raw materials |
|