|
|
| | N,N-Dimethyl-5-methoxytryptamine Basic information |
| Product Name: | N,N-Dimethyl-5-methoxytryptamine | | Synonyms: | 3-(2-DIMETHYLAMINOETHYL)-5-METHOXYINDOLE;5-OME-DMT;5-METHOXY-DMT;5-METHOXY-N,N-DIMETHYLTRYPTAMINE;TIMTEC-BB SBB003367;N-[2-(5-METHOXY-1H-INDOL-3-YL)ETHYL]-N,N-DIMETHYLAMINE;N,N-DIMETHYL-5-METHOXYTRYPTAMINE;2-(5-Methoxy-1H-indol-3-yl)-N,N-dimethylethanamine | | CAS: | 1019-45-0 | | MF: | C13H18N2O | | MW: | 218.29 | | EINECS: | 213-813-2 | | Product Categories: | Research Chemical;Tryptamines | | Mol File: | 1019-45-0.mol |  |
| | N,N-Dimethyl-5-methoxytryptamine Chemical Properties |
| Melting point | 69 °C | | Boiling point | 358.99°C (rough estimate) | | density | 1.0346 (rough estimate) | | refractive index | 1.6450 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 16.94±0.30(Predicted) | | color | Pale Beige | | Water Solubility | PRACTICALLY INSOLUBLE | | Major Application | forensics and toxicology | | InChI | 1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 | | InChIKey | ZSTKHSQDNIGFLM-UHFFFAOYSA-N | | SMILES | CN(C)CCC1=CNC2=CC=C(OC)C=C21 | | CAS DataBase Reference | 1019-45-0(CAS DataBase Reference) | | NIST Chemistry Reference | 1H-Indole-3-ethanamine, 5-methoxy-N,N-dimethyl-(1019-45-0) |
| Hazard Codes | C,Xn | | Risk Statements | 20-34-43-21/22 | | Safety Statements | 22-26-28A-36/37/39-45-36-24/25 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | WGK 2 | | RTECS | NL7380000 | | HS Code | 29339980 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | N,N-Dimethyl-5-methoxytryptamine Usage And Synthesis |
| Description | Obtained from Desmodium pulchellum Benth ex Baker, and also from Phalaris
tuberosa L., this indole alkaloid is best crystallized from Et20-light petroleum
when it yields colourless rectangular plates. It is optically inactive and the ultraviolet
spectrum has absorption maxima at 224, 277 and 296 mil. It forms a
crystalline picrate as orange-yellow needles, m.p. 176-7°C and the methiodide,
m.p. 181-2°C. | | Chemical Properties | off-white to slightly yellow crystalline powder | | Uses | Hallucinogen; non-selective serotonin receptor agonist | | Uses | 5-Methoxy-N,N-dimethyltryptamine is a tryptamine derivative and a full potent agonist used in the study of mammalian hormones to stimukate cAMP formation by colliculi neurons and mediate serotoninergic receptors. It is a natural hallucinogen component of Ayahuasca, an Amazonian beverage and is currently being made as a designer drug. | | Definition | ChEBI: A tryptamine alkaloid that is N,N-dimethyltryptamine substituted by a methoxy group at position 5. | | References | Culvenor, Brown, Smith., Austral. J. Chern., 17, 1301 (1964)
Ghosal, Mukherjee., Chern. Ind., 793 (1965)
Ghosal, Mukherjee., J. Org. Chern., 31, 2284 (1966) |
| | N,N-Dimethyl-5-methoxytryptamine Preparation Products And Raw materials |
|