|
|
| | 3-(2-Bromophenyl)propionic acid Basic information | | Uses |
| | 3-(2-Bromophenyl)propionic acid Chemical Properties |
| Melting point | 98-102 °C (lit.) | | Boiling point | 186°C/15mmHg(lit.) | | density | 1.531±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.60±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C9H9BrO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) | | InChIKey | AOACQJFIGWNQBC-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=CC=C1Br | | CAS DataBase Reference | 15115-58-9(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3261 | | WGK Germany | 2 | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 3-(2-Bromophenyl)propionic acid Usage And Synthesis |
| Uses | 3-(2-bromophenyl)propionic acid is an inexpensive and readily available raw material. The structure of the raw material itself is very similar to that of phenyllactic acid. If a hydroxyl group can be introduced at the α-position of its carboxylic acid branch, this would be a simple method for synthesizing tanshinone derivatives. | | Chemical Properties | White solid |
| | 3-(2-Bromophenyl)propionic acid Preparation Products And Raw materials |
|