|
|
| | 1,3-DIBENZOYLOXYBENZENE Basic information |
| Product Name: | 1,3-DIBENZOYLOXYBENZENE | | Synonyms: | 3-(Benzoyloxy)phenyl benzoate;Dibenzoylresorcinol;1,3-BENZENEDIOL DIBENZOATE;1,3-DIBENZOYLOXYBENZENE;1,3-PHENYLENEDIBENZOATE;M-PHENYLENE DIBENZOATE;1,3-Bis(benzoyloxy)benzene;Bisbenzoic acid 1,3-phenylene ester | | CAS: | 94-01-9 | | MF: | C20H14O4 | | MW: | 318.32 | | EINECS: | 202-294-8 | | Product Categories: | Aromatic Esters;1 | | Mol File: | 94-01-9.mol |  |
| | 1,3-DIBENZOYLOXYBENZENE Chemical Properties |
| Melting point | 115-117 °C | | Boiling point | 450 °C | | density | 1.2086 (rough estimate) | | refractive index | 1.5400 (estimate) | | Fp | 93°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Acetone | | form | powder to crystal | | color | White to Almost white | | BRN | 2059467 | | InChI | InChI=1S/C20H14O4/c21-19(15-8-3-1-4-9-15)23-17-12-7-13-18(14-17)24-20(22)16-10-5-2-6-11-16/h1-14H | | InChIKey | SUQGLJRNDJRARS-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C2=CC=CC=C2)=CC=CC(OC(=O)C2=CC=CC=C2)=C1 | | CAS DataBase Reference | 94-01-9(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Benzenediol, dibenzoate (94-01-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | RTECS | VH0590000 | | TSCA | TSCA listed | | HS Code | 29173990 | | Toxicity | LD50 ipr-mus: 8000 mg/kg JAPMA8 46,185,57 |
| | 1,3-DIBENZOYLOXYBENZENE Usage And Synthesis |
| Chemical Properties | WHITE TO BEIGE OR PALE BROWN CRYSTALLINE POWDER | | Safety Profile | Slightly toxic by intraperitonealroute. When heated to decomposition it emits acrid smokeand irritating vapors. |
| | 1,3-DIBENZOYLOXYBENZENE Preparation Products And Raw materials |
|