11C,14C-EICOSADIENOIC ACID manufacturers
- Eicosadienoic acid
-
- $41.00 / 5mg
-
2026-03-24
- CAS:2091-39-6
- Min. Order:
- Purity: 98.42%
- Supply Ability: 10g
|
| | 11C,14C-EICOSADIENOIC ACID Basic information |
| | 11C,14C-EICOSADIENOIC ACID Chemical Properties |
| Boiling point | 198 °C0.08 mm Hg(lit.) | | density | 0.905±0.06 g/cm3(Predicted) | | Fp | 62 °C | | storage temp. | -20°C | | solubility | 0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) | | pka | 4.78±0.10(Predicted) | | form | liquid | | color | Colorless to light yellow | | biological source | plant | | Major Application | food and beverages | | InChI | 1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6-,10-9- | | InChIKey | XSXIVVZCUAHUJO-HZJYTTRNSA-N | | SMILES | CCCCC\C=C/C\C=C/CCCCCCCCCC(O)=O | | CAS DataBase Reference | 2091-39-6(CAS DataBase Reference) |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 11C,14C-EICOSADIENOIC ACID Usage And Synthesis |
| Uses | 11,14-Eicosadienoic Acid is studied in metabolic profiling of human colorectal cancer. | | Definition | ChEBI: Eicosa-11,14-dienoic acid is a long-chain fatty acid. | | IC 50 | Human Endogenous Metabolite |
| | 11C,14C-EICOSADIENOIC ACID Preparation Products And Raw materials |
|