- Fmoc-Met-OH
-
-
2026-07-07
- CAS:112883-40-6
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 500kg/month
- Fmoc-D-Met-OH
-
-
2026-07-07
- CAS:112883-40-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Fmoc-Met-OH Basic information |
| | Fmoc-Met-OH Chemical Properties |
| Melting point | 132 °C | | Boiling point | 614.6±55.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | refractive index | 30 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMF (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.72±0.10(Predicted) | | color | White to Off-White | | BRN | 5384578 | | Major Application | peptide synthesis | | InChI | 1S/C20H21NO4S/c1-26-11-10-18(19(22)23)21-20(24)25-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2,1H3,(H,21,24)(H,22,23)/t18-/m1/s1 | | InChIKey | BUBGAUHBELNDEW-GOSISDBHSA-N | | SMILES | CSCC[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O | | CAS DataBase Reference | 112883-40-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Met-OH Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | N-Fmoc-D-methionine is an N-Fmoc-protected form of D-Methionine (M260550). D-Methionine is an isomer of L-Methionine (M260440), and is known to be a cytoprotectant against Cisplatin (C499500), an anticancer agent. D-Methionine is also used to prevent noise- and drug-induced hearing loss, as well as hair loss (all of which may also be caused by Cisplatin or aminoglycosides). | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Met-OH Preparation Products And Raw materials |
|