4,4'-DDA manufacturers
- 4,4'-DDA
-
-
2019-11-08
- CAS:83-05-6
- Min. Order: 1g
- Purity: 99.5%min
- Supply Ability: 20kg/week
|
| | 4,4'-DDA Basic information |
| | 4,4'-DDA Chemical Properties |
| Melting point | 167-169 °C (lit.) | | Boiling point | 392.54°C (rough estimate) | | density | 1.2624 (rough estimate) | | refractive index | 1.4730 (estimate) | | storage temp. | 0-6°C | | pka | 4.51±0.10(Predicted) | | BRN | 1913593 | | InChI | 1S/C14H10Cl2O2/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13H,(H,17,18) | | InChIKey | YIOCIFXUGBYCJR-UHFFFAOYSA-N | | SMILES | OC(=O)C(c1ccc(Cl)cc1)c2ccc(Cl)cc2 | | EPA Substance Registry System | p,p'-Dichlorodiphenylacetic acid (83-05-6) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-40 | | Safety Statements | 7-22-36-45 | | WGK Germany | 3 | | RTECS | AF5475000 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 | | Toxicity | sln-dmg-orl 3700 mmol/L MUREAV 16,157,72 |
| | 4,4'-DDA Usage And Synthesis |
| Chemical Properties | White crystals, melting point 140-142°C. | | Definition | ChEBI: A organochlorine compound comprising acetic acid having two 4-chlorophenyl substituents attached at the 2-position. | | Safety Profile | Moderately toxic by ingestion. Anexperimental teratogen. Other experimental reproductiveeffects. Mutation data reported. When heated todecomposition it emits toxic fumes of Cl-. |
| | 4,4'-DDA Preparation Products And Raw materials |
|