|
|
| | 9(10)-Dehydronandrolone Basic information |
| | 9(10)-Dehydronandrolone Chemical Properties |
| Melting point | 190°C(lit.) | | Boiling point | 466.8±45.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 15.00±0.40(Predicted) | | color | Light yellow to Yellow to Orange | | Water Solubility | 53mg/L at 20℃ | | InChI | InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,15-17,20H,2-9H2,1H3/t15-,16+,17+,18+/s3 | | InChIKey | PUQSDJZESAQGQS-IWZYPTQDNA-N | | SMILES | C12CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)CCC=21)O |&1:3,5,8,10,r| | | LogP | 2.4 at 25℃ |
| | 9(10)-Dehydronandrolone Usage And Synthesis |
| Chemical Properties | Off-white Solid | | Uses | Gestagenic Testosterone (T155000) derivative. A steroid ligand for the cytosol androgen receptor (AR) of rat prostate. |
| | 9(10)-Dehydronandrolone Preparation Products And Raw materials |
|