|
|
| | RARECHEM AL BE 1403 Basic information |
| Product Name: | RARECHEM AL BE 1403 | | Synonyms: | RARECHEM AL BE 1403;3-Methoxy-4-phenylbenzoic acid;2-Methoxy-[1,1'-biphenyl]-4-carboxylic acid | | CAS: | 175153-20-5 | | MF: | C14H12O3 | | MW: | 228.24 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | RARECHEM AL BE 1403 Chemical Properties |
| Melting point | 183-184 °C | | Boiling point | 370.0±30.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.07±0.10(Predicted) | | InChI | InChI=1S/C14H12O3/c1-17-13-9-11(14(15)16)7-8-12(13)10-5-3-2-4-6-10/h2-9H,1H3,(H,15,16) | | InChIKey | RZWKYHIPLJQCJV-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(C(O)=O)C=C1OC |
| | RARECHEM AL BE 1403 Usage And Synthesis |
| | RARECHEM AL BE 1403 Preparation Products And Raw materials |
|