1-BROMOPERFLUOROHEXANE manufacturers
- Perfluorobromohexane
-
- $0.00 / 20KG
-
2025-11-29
- CAS:335-56-8
- Min. Order: 2000KG
- Purity: 99.9%
- Supply Ability: 20tons
|
| | 1-BROMOPERFLUOROHEXANE Basic information |
| Product Name: | 1-BROMOPERFLUOROHEXANE | | Synonyms: | PERFLUOROHEXYL BROMIDE;1-BROMOTRIDECAFLUOROHEXANE;6-chloro-N-(1-methylcyclopropyl)-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-amine;1-BROMOPERFLUOROHEXANE;1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane;Perfluorohexyl bromide 98%;Perfluorohexylbromide98%;Tridecafluorohexyl Bromide | | CAS: | 335-56-8 | | MF: | C6BrF13 | | MW: | 398.95 | | EINECS: | 206-391-6 | | Product Categories: | Alkyl;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;F-Tagged;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks | | Mol File: | 335-56-8.mol |  |
| | 1-BROMOPERFLUOROHEXANE Chemical Properties |
| Melting point | -49℃ | | Boiling point | 97 °C(lit.) | | density | 1.871 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.3(lit.) | | Fp | 100-101°C | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.871 | | BRN | 1714896 | | InChI | InChI=1S/C6BrF13/c7-5(16,17)3(12,13)1(8,9)2(10,11)4(14,15)6(18,19)20 | | InChIKey | JTYRBFORUCBNHJ-UHFFFAOYSA-N | | SMILES | C(Br)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 335-56-8(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorohexylbromide (335-56-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29037800 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-BROMOPERFLUOROHEXANE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Employed in the preparation of perfluorononanal by hydroformylation.1,2 |
| | 1-BROMOPERFLUOROHEXANE Preparation Products And Raw materials |
| Raw materials | Pentane, 1-bromo-1,1,2,2,3,3,4,4,5,5,5-undecafluoro--->Pentane, 1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decafluoro--->1,4-DIBROMOOCTAFLUOROBUTANE-->1-BROMONONAFLUOROBUTANE-->1,2-Dibromotetrafluoroethane-->Tetrafluoroethylene |
|