|
|
| | (S)-3,3,3-TRIFLUORO-2-HYDROXY-2-METHYLPROPIONIC ACID Basic information |
| Product Name: | (S)-3,3,3-TRIFLUORO-2-HYDROXY-2-METHYLPROPIONIC ACID | | Synonyms: | (S)-3,3,3-Trifluoro-2-hydroxy-2-methylpropionic;(+)-3,3,3-Trifluoro-2-methyl-D-lactic acid;(S)-2-Hydroxy-2-methyl-3,3,3-trifluoropropanoic acid;(S)-3,3,3-Trifluoro-2-hydroxy-2-methylpropanoic acid;(S)-α-(Trifluoromethyl)lactic acid;(S)-2-Hydroxy-2-trifluoro-oro-methylpropionic acid;(2S)-2-Hydroxy-2-(trifluoromethyl)propanoic acid 95+%;(2S)-2-Hydroxy-2-methyl-3,3,3-trifluoropropanoic acid | | CAS: | 24435-45-8 | | MF: | C4H5F3O3 | | MW: | 158.08 | | EINECS: | | | Product Categories: | Carboxylic Acids (Chiral);Chiral Building Blocks;Synthetic Organic Chemistry | | Mol File: | 24435-45-8.mol |  |
| | (S)-3,3,3-TRIFLUORO-2-HYDROXY-2-METHYLPROPIONIC ACID Chemical Properties |
| Melting point | 110 °C | | Boiling point | 60-64°C 20mm | | density | 1.532±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | -16.5 ° (C=5, H2O) | | Fp | 103.4±25.9℃ | | storage temp. | Inert atmosphere,2-8°C | | Water Solubility | Soluble in water | | pka | 2.46±0.22(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C4H5F3O3/c1-3(10,2(8)9)4(5,6)7/h10H,1H3,(H,8,9)/t3-/m0/s1 | | InChIKey | CTGJACFEVDCYMC-VKHMYHEASA-N | | SMILES | C(O)(=O)[C@@](O)(C)C(F)(F)F | | CAS DataBase Reference | 24435-45-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3261 8/PG III | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 2918199890 | | Storage Class | 11 - Combustible Solids |
| | (S)-3,3,3-TRIFLUORO-2-HYDROXY-2-METHYLPROPIONIC ACID Usage And Synthesis |
| | (S)-3,3,3-TRIFLUORO-2-HYDROXY-2-METHYLPROPIONIC ACID Preparation Products And Raw materials |
|