| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:1H,1H,5H-OCTAFLUOROPENTYL IODIDE
CAS:678-74-0
|
|
| | 1H,1H,5H-OCTAFLUOROPENTYL IODIDE Basic information |
| Product Name: | 1H,1H,5H-OCTAFLUOROPENTYL IODIDE | | Synonyms: | DAIKIN I-5410;1H,1H,5H-1-Iodooctafluoropentane;1H,1H,5H-Octafluoropentyl iodide 98%;1H,1H,5H-Octafluoropentyliodide98%;1,1,2,2,3,3,4,4-OCTAFLUORO-5-IODOPENTANE;1H,1H,5H-OCTAFLUORO-1-IODOPENTANE;1H,1H,5H-OCTAFLUOROPENTYL IODIDE;1-IODO-2,2,3,3,4,4,5,5-OCTAFLUOROPENTANE | | CAS: | 678-74-0 | | MF: | C5H3F8I | | MW: | 341.97 | | EINECS: | | | Product Categories: | | | Mol File: | 678-74-0.mol |  |
| | 1H,1H,5H-OCTAFLUOROPENTYL IODIDE Chemical Properties |
| Boiling point | 81-82 °C120 mm Hg(lit.) | | density | 2.061 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.38(lit.) | | Specific Gravity | 2.009 | | InChI | 1S/C5H3F8I/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h2H,1H2 | | InChIKey | YMGYSVVJRMSEGU-UHFFFAOYSA-N | | SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CI | | CAS DataBase Reference | 678-74-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2903798000 | | Storage Class | 12 - Non Combustible Liquids |
| | 1H,1H,5H-OCTAFLUOROPENTYL IODIDE Usage And Synthesis |
| Uses | 1,1,2,2,3,3,4,4-Octafluoro-5-iodopentane is a halogenated hydrocarbon useful in organic synthesis studies. | | General Description | 1,1,2,2,3,3,4,4-Octafluoro-5-iodopentane is a halogenated hydrocarbon useful in organic synthesis studies. |
| | 1H,1H,5H-OCTAFLUOROPENTYL IODIDE Preparation Products And Raw materials |
|