3-TRIFLUOROACETYL-D-CAMPHOR manufacturers
|
| | 3-TRIFLUOROACETYL-D-CAMPHOR Basic information |
| Product Name: | 3-TRIFLUOROACETYL-D-CAMPHOR | | Synonyms: | 3-TRIFLUOROACETYL-D-CAMPHOR;1,7,7-Trimethyl-3-(trifluoroacetyl)bicyclo[2.2.1]heptan-2-one;Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-3-(trifluoroacetyl)-, (1R)-;(1R)-1,7,7-trimethyl-3-(trifluoroacetyl)bicyclo[2.2.1]heptan-2-one;3-Trifluoroacetyl-D-camphor 98%;3-Trifluoroacetyl-D-camphor98%;(1R,4R)-1,7,7-Trimethyl-3-(trifluoroacetyl)bicyclo[2.2.1]heptan-2-one;(1R,4R)-3-(Trifluoroacetyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-one | | CAS: | 51800-98-7 | | MF: | C12H15F3O2 | | MW: | 248.24 | | EINECS: | 257-429-3 | | Product Categories: | | | Mol File: | 51800-98-7.mol |  |
| | 3-TRIFLUOROACETYL-D-CAMPHOR Chemical Properties |
| Boiling point | 100-101 °C16 mm Hg(lit.) | | density | 1.172 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.451(lit.) | | Fp | 180 °F | | form | liquid | | Optical Rotation | [α]19/D +148°, c = 2.3 in methylene chloride | | BRN | 6779716 | | InChI | InChI=1S/C12H15F3O2/c1-10(2)6-4-5-11(10,3)8(16)7(6)9(17)12(13,14)15/h6-7H,4-5H2,1-3H3/t6-,7,11+/m1/s1 | | InChIKey | ISLOIHOAZDSEAJ-XGLFCGLISA-N | | SMILES | [C@]12(C)C(C)(C)[C@]([H])(CC1)C(C(C(F)(F)F)=O)C2=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29147000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-TRIFLUOROACETYL-D-CAMPHOR Usage And Synthesis |
| Chemical Properties | Clear slightly pink-orange liquid | | Uses | (+)-3-(Trifluoroacetyl)camphor is a trifluoroacetylated camphor derivative compound. |
| | 3-TRIFLUOROACETYL-D-CAMPHOR Preparation Products And Raw materials |
|