|
|
| | 4-ETHYL-2-FLUORO-1,1'-BIPHENYL Basic information |
| Product Name: | 4-ETHYL-2-FLUORO-1,1'-BIPHENYL | | Synonyms: | Flurbiprofen Related Impurity;Flurbiprofen EP Impurity F;4-ethyl-2-fluoro-1,1-biphenyl(Flurbiprofen EP Impurity F);4-ethyl-2-fluoro-1-phenylbenzene;Flurbiprofen Impurity G;Flurbiprofen Impurity 6;Flurbiprofen EP Impurity;1,1'-Biphenyl, 4-ethyl-2-fluoro- | | CAS: | 55258-76-9 | | MF: | C14H13F | | MW: | 200.25 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-ETHYL-2-FLUORO-1,1'-BIPHENYL Chemical Properties |
| Boiling point | 276.8±19.0 °C(Predicted) | | density | 1.044±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C14H13F/c1-2-11-8-9-13(14(15)10-11)12-6-4-3-5-7-12/h3-10H,2H2,1H3 | | InChIKey | GEBUSPQBSWYLBN-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(CC)C=C1F |
| | 4-ETHYL-2-FLUORO-1,1'-BIPHENYL Usage And Synthesis |
| Uses | 4-Ethyl-2-fluoro-1,1''-biphenyl is a photoproduct of Flurbiprofen (F598700), an anti-inflammatory used as an analgesic. |
| | 4-ETHYL-2-FLUORO-1,1'-BIPHENYL Preparation Products And Raw materials |
|