|
|
| | N-Benzylcinchonidinium chloride Basic information |
| Product Name: | N-Benzylcinchonidinium chloride | | Synonyms: | Cinchonanium, 9-hydroxy-1-(phenylmethyl)-, chloride, (8.alpha.,9R)-;(8alpha,9R)-1-benzyl-9-hydroxycinchonanium chloride;(8S,9R)-(-)-BENZYLCINCHONIDINIUM CHLORID E, 98%;N-BENZYLCINCHONIDINIUM CHLORIDE HYDRATE;N-Benzylcinchonidinium Chloride [Chiral Phase-Transfer Catalyst];[5-ethenyl-1-(phenylmethyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(4-quinolinyl)methanol;(R)-[(1S,2S,4S,5R)-1-benzyl-5-vinyl-quinuclidin-1-ium-2-yl]-(4-quinolyl)methanol;N-Benzylcinchonidinium chloride, BCDC | | CAS: | 69257-04-1 | | MF: | C26H29ClN2O | | MW: | 420.97 | | EINECS: | 273-938-3 | | Product Categories: | Quinoline Alkaloids;Alkaloids;Ammonium Chlorides (Quaternary);Asymmetric Synthesis;Biochemistry;Quaternary Ammonium Compounds;Quinolinecarboxylic Acids, etc.;Quinolines;Synthetic Organic Chemistry;chiral;Chiral Phase-Transfer Catalysts | | Mol File: | 69257-04-1.mol |  |
| | N-Benzylcinchonidinium chloride Chemical Properties |
| Melting point | 210 °C (dec.)(lit.) | | alpha | -188 º (c=0.4% in H2O) | | refractive index | -184 ° (C=1, H2O) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow to Light orange | | Optical Rotation | [α]20/D 180°, c = 1.3 in H2O | | BRN | 5421832 | | InChIKey | FCHYSBWCOKEPNQ-WOIURNJWSA-M | | SMILES | [N+]12(CC[C@]([H])([C@@H](C=C)C1)C[C@@]2([H])[C@H](O)C1=CC=NC2C=CC=CC1=2)CC1C=CC=CC=1.[Cl-] |&1:3,5,10,12,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 2811 | | WGK Germany | 3 | | HS Code | 29392000 |
| | N-Benzylcinchonidinium chloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Purification Methods | Dissolve the chloride in the minimum volume of H2O and add absolute Me2CO. Filter it off and dry it in a vacuum. It can also be recrystallised from hot EtOH or EtOH/Et2O. (A good chiral phase transfer catalyst-see above) [Colonna et al. J Chem Soc, Perkin Trans 1 547 1981, Imperali & Fisher J Org Chem 57 757 1992]. [Beilstein 23 H 446.] See cinchonidine below. |
| | N-Benzylcinchonidinium chloride Preparation Products And Raw materials |
|