| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | 2-(4-Trifluoromethoxyphenyl)propionic acid Basic information |
| Product Name: | 2-(4-Trifluoromethoxyphenyl)propionic acid | | Synonyms: | 3-[4-(Trifluoromethoxy)phenyl]propanoic acid;4-(Trifluoromethoxy)hydrocinnamic acid, 3-[4-Trifluoromethoxy)phenyl]propionic acid;4-(TRIFLUOROMETHOXY)HYDROCINNAMIC ACID;4-(Trifluoromethoxy)hydrocinnemic acid;Benzenepropanoic acid, 4-?(trifluoromethoxy)?-;4-(Trifluoromethoxy)benzenepropanoic acid;2-(4-Trifluoromethoxyphenyl)propionic acid | | CAS: | 886499-74-7 | | MF: | C10H9F3O3 | | MW: | 234.17 | | EINECS: | | | Product Categories: | Aromatic Propionic Acids | | Mol File: | Mol File |  |
| | 2-(4-Trifluoromethoxyphenyl)propionic acid Chemical Properties |
| Boiling point | 277.3±35.0 °C(Predicted) | | density | 1.347±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.57±0.10(Predicted) | | form | solid | | Appearance | White to light yellow Solid | | InChI | 1S/C10H9F3O3/c1-6(9(14)15)7-2-4-8(5-3-7)16-10(11,12)13/h2-6H,1H3,(H,14,15) | | InChIKey | BEBMIASBVSVAQI-UHFFFAOYSA-N | | SMILES | CC(C(O)=O)c1ccc(OC(F)(F)F)cc1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HS Code | 2918999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(4-Trifluoromethoxyphenyl)propionic acid Usage And Synthesis |
| | 2-(4-Trifluoromethoxyphenyl)propionic acid Preparation Products And Raw materials |
|