|
|
| | 3,4,5-Trimethoxybenzaldehyde Basic information |
| Product Name: | 3,4,5-Trimethoxybenzaldehyde | | Synonyms: | 3,4,5-methoxybenzaldehyde;3,4,5-TriMethoxybenzaldenyde;Three, four, five - preparation benzaldehyde;3,4,5-Trimethoxybenzaldeh;3,4,5-tiMethoxybenzaldehyde;3,4,5-TrimethoxybenZHldehyde;Trimetazidine Impurity 9;OTAVA-BB BB7018801952 | | CAS: | 86-81-7 | | MF: | C10H12O4 | | MW: | 196.2 | | EINECS: | 201-701-6 | | Product Categories: | Oxepin;Aromatic Aldehydes & Derivatives (substituted);FINE Chemical & INTERMEDIATES;Aromatics;Miscellaneous Reagents;Aldehydes;C10 to C21;Carbonyl Compounds;86-81-7 | | Mol File: | 86-81-7.mol |  |
| | 3,4,5-Trimethoxybenzaldehyde Chemical Properties |
| Melting point | 72-74 °C (lit.) | | Boiling point | 163-165 °C/10 mmHg (lit.) | | density | 1.2166 (rough estimate) | | refractive index | 1.5550 (estimate) | | Fp | 163-165°C/10mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | methanol: 0.1 g/mL, clear | | form | Powder or Flakes | | color | White to creamy | | Water Solubility | slightly soluble | | Sensitive | Air Sensitive | | BRN | 395163 | | Stability: | Hygroscopic | | InChI | 1S/C10H12O4/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-6H,1-3H3 | | InChIKey | OPHQOIGEOHXOGX-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cc(OC)c(OC)c(OC)c1 | | LogP | 1.390 | | CAS DataBase Reference | 86-81-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzaldehyde, 3,4,5-trimethoxy-(86-81-7) | | EPA Substance Registry System | Benzaldehyde, 3,4,5-trimethoxy- (86-81-7) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34 | | Safety Statements | 22-24/25-45-36/37/39-27-26 | | RIDADR | UN2811 | | WGK Germany | 3 | | RTECS | CU8462000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29124900 | | Storage Class | 11 - Combustible Solids |
| | 3,4,5-Trimethoxybenzaldehyde Usage And Synthesis |
| Chemical Properties | white to creamy powder or flakes | | Uses | 3,4,5-Trimethoxybenzaldehyde (cas# 86-81-7) is a compound useful in organic synthesis. |
| | 3,4,5-Trimethoxybenzaldehyde Preparation Products And Raw materials |
| Raw materials | Sodium Methoxide-->Vanillin-->Benzonitrile-->4-Nitrotoluene-->4-Hydroxybenzaldehyde-->Tannic acid-->potassium ferricyanide-->2,2-dimethyl-5-(3,4,5-trimethoxybenzylidene)-1,3-dioxane-4,6-dione-->3,4,5-TRIMETHOXYBENZHYDRAZIDE | | Preparation Products | 3,4,5-Trimethoxybenzylamine-->RARECHEM AL BI 0736-->4-Hydroxy-3,5-dimethoxycinnamic acid-->Syringaldehyde-->3-(3,4,5-TRIMETHOXYPHENYL)PROPIONIC ACID-->3,4,5-Trimethoxy benzoic acid-->3,4,5-Trimethoxyphenol-->5-BROMOMETHYL-1,2,3-TRIMETHOXY-BENZENE-->3,4,5-Trimethoxytoluene-->5-METHYLPYROGALLOL-->1,2,3-Trimethoxy-5-vinylbenzene |
|