|
|
| | alpha-Hydroxybenzenepropanoic acid methyl ester Basic information |
| Product Name: | alpha-Hydroxybenzenepropanoic acid methyl ester | | Synonyms: | (S)-2-HYDROXY-3-PHENYL-PROPIONIC ACID-METHYL ESTER;(S)-3-PHENYLLACTIC ACID, METHYL ESTER;l-3-phenyl-lactic acid methyl ester;L(-) PHENYLLACTIC ACID METHYL ESTER;L-METHYL 3-PHENYLLACTATE;L-METHYL-BETA-PHENYLLACTATE;METHYL L-3-PHENYLLACTATE;METHYL (S)-2-HYDROXY-3-PHENYLPROPIONATE | | CAS: | 13673-95-5 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | | | Product Categories: | chiral | | Mol File: | 13673-95-5.mol |  |
| | alpha-Hydroxybenzenepropanoic acid methyl ester Chemical Properties |
| Melting point | 40-45 °C (lit.) | | alpha | -20.0 º(c=2,H2O) | | Boiling point | 110-115 °C(Press: 3 Torr) | | density | 1.150 | | Fp | 120°C | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.00±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]/D +4.4±0.5°, c = 1% in methanol | | InChI | 1S/C10H12O3/c1-13-10(12)9(11)7-8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3/t9-/m0/s1 | | InChIKey | NMPPJJIBQQCOOI-VIFPVBQESA-N | | SMILES | COC(=O)[C@@H](O)Cc1ccccc1 | | CAS DataBase Reference | 13673-95-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids |
| | alpha-Hydroxybenzenepropanoic acid methyl ester Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Methyl?L-3-phenyllactate can be used:
- As an intermediate in the synthesis of bortezomib analogs as 20S proteasome inhibitors.
- As a substrate in the amination of the benzylic C-H bonds and the aminated products are further used to prepare β-lactams.
- As an intermediate in one of the key synthetic steps for the preparation of YM-254890 analog, a selective Gαq/11 inhibitor.
|
| | alpha-Hydroxybenzenepropanoic acid methyl ester Preparation Products And Raw materials |
|