- Fmoc-D-Phe-OH
-
- $0.00/ kg
-
2026-01-20
- CAS:86123-10-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Fmoc-D-phenylalanine Basic information |
| | Fmoc-D-phenylalanine Chemical Properties |
| Melting point | 181-185°C | | Boiling point | 620.1±50.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | refractive index | 38 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.77±0.10(Predicted) | | form | Powder or Crystalline Powder | | color | White | | Optical Rotation | 39°(C=0.01 g/mI, DMF, 20°C, 589nm) | | BRN | 4767931 | | Major Application | peptide synthesis | | InChI | InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m1/s1 | | InChIKey | SJVFAHZPLIXNDH-JOCHJYFZSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 86123-10-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-D-phenylalanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Fmoc-D-phenylalanine is an N-Fmoc-protected form of D-Phenylalanine (P319410). D-Phenylalanine is an essential amino acid that serves as a primary precursor for the biosynthesis of catecholamines in the body. D-Phenylalanine is also known to antagonize stress-induced analgesia in humans, and also acts as an anti-enkephalinase agent. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-D-phenylalanine Preparation Products And Raw materials |
|