- 3,6-OCTANDIONE
-
-
2025-04-04
- CAS:2955-65-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- 3,6-OCTANDIONE
-
- $7000.00
-
2019-07-06
- CAS:2955-65-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 3,6-OCTANDIONE Basic information |
| Product Name: | 3,6-OCTANDIONE | | Synonyms: | OCTANE-3,6-DIONE;3,6-OCTANDIONE;3,6-octanedione;AT-31115;3,6-Octanedione (6CI, 7CI, 8CI, 9CI, ACI);3,6-octyldione | | CAS: | 2955-65-9 | | MF: | C8H14O2 | | MW: | 142.2 | | EINECS: | 922-430-6 | | Product Categories: | Aliphatics | | Mol File: | 2955-65-9.mol |  |
| | 3,6-OCTANDIONE Chemical Properties |
| Melting point | 34-36℃ | | Boiling point | 227℃ | | density | 0.918 | | refractive index | 1.4559 (estimate) | | Fp | 82℃ | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C8H14O2/c1-3-7(9)5-6-8(10)4-2/h3-6H2,1-2H3 | | InChIKey | CVZGUJMLZZTPKH-UHFFFAOYSA-N | | SMILES | CCC(=O)CCC(=O)CC | | LogP | 0.928 (est) | | EPA Substance Registry System | 3,6-Octanedione (2955-65-9) |
| | 3,6-OCTANDIONE Usage And Synthesis |
| Chemical Properties | Pale Yellow Low Melting Solid | | Uses | It is involved in enzymic stereoselective reduction of diketones into chiral diols. | | Synthesis Reference(s) | Journal of the American Chemical Society, 97, p. 2912, 1975 DOI: 10.1021/ja00843a057 |
| | 3,6-OCTANDIONE Preparation Products And Raw materials |
|