- acridinic acid
-
- $1.00 / 1g
-
2025-02-13
- CAS:643-38-9
- Min. Order: 1g
- Purity: 0.98
- Supply Ability: 1000
|
| | 2,3-Quinoline dicarboxylic acid Basic information | | Application |
| Product Name: | 2,3-Quinoline dicarboxylic acid | | Synonyms: | QUINOLINE-2,3-DICARBOXYLIC ACID;2,3-QUINOLINE DICARBOXYLIC ACID;2,3-Quinolinedicarboxylic;Acridic acid;2,3-Quinoline dicarb;2,3-Quinoline dicarboxylic acid (QDC);1-acridinecarboxylic acid;quinoline-2,3-dicarboxylicaci | | CAS: | 643-38-9 | | MF: | C11H7NO4 | | MW: | 217.18 | | EINECS: | | | Product Categories: | | | Mol File: | 643-38-9.mol |  |
| | 2,3-Quinoline dicarboxylic acid Chemical Properties |
| Melting point | 183 °C(Solv: benzene (71-43-2); ligroine (8032-32-4)) | | Boiling point | 423.7±40.0 °C(Predicted) | | density | 1.531±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.33±0.30(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H7NO4/c13-10(14)7-5-6-3-1-2-4-8(6)12-9(7)11(15)16/h1-5H,(H,13,14)(H,15,16) | | InChIKey | YHUVMHKAHWKQBI-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C=C(C(O)=O)C=1C(O)=O | | CAS DataBase Reference | 643-38-9(CAS DataBase Reference) | | EPA Substance Registry System | 2,3-Quinolinedicarboxylic acid (643-38-9) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids |
| | 2,3-Quinoline dicarboxylic acid Usage And Synthesis |
| Application | 2,3-Quinolinedicarboxylic acid can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 25, p. 1777, 1988 DOI: 10.1002/jhet.5570250634
Synthetic Communications, 16, p. 157, 1986 DOI: 10.1080/00397918608057703
Tetrahedron Letters, 43, p. 767, 2002 DOI: 10.1016/S0040-4039(01)02265-1 |
| | 2,3-Quinoline dicarboxylic acid Preparation Products And Raw materials |
|