|
|
| | 1,4-Dibromo-2,5-difluorobenzene Basic information |
| Product Name: | 1,4-Dibromo-2,5-difluorobenzene | | Synonyms: | 2,5-Difluoro-1,4-Dibromrobenzene;1,4-Dibromo-2,5-difluorobenzene 98%;1,4-Dibromo-2,5-difluorobenzene98%;1,4-Difluoro-2,5-dibromobenzene;2,5-Difluoro-1,4-phenylene dibromide;Benzene, 1,4-dibromo-2,5-difluoro-;2,5-Difluoro-1,4-ph;1,4-Dibromo-2,5-difl | | CAS: | 327-51-5 | | MF: | C6H2Br2F2 | | MW: | 271.88 | | EINECS: | 206-317-2 | | Product Categories: | Bromine Compounds;Fluorine Compounds;Aryl;Halogenated Hydrocarbons;bc0001;C6 | | Mol File: | 327-51-5.mol |  |
| | 1,4-Dibromo-2,5-difluorobenzene Chemical Properties |
| Melting point | 60-62 °C (lit.) | | Boiling point | 96 °C/20 mmHg (lit.) | | density | 2.1030 (rough estimate) | | refractive index | 1.5151 (estimate) | | Fp | 96°C/20mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | form | powder to crystal | | color | White to Almost white | | Water Solubility | insoluble | | BRN | 2250095 | | InChI | InChI=1S/C6H2Br2F2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H | | InChIKey | GLVMLJCMUBZVTJ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=C(Br)C=C1F | | CAS DataBase Reference | 327-51-5(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Dibromo-2,5-difluorobenzene(327-51-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 |
| | 1,4-Dibromo-2,5-difluorobenzene Usage And Synthesis |
| Chemical Properties | white adhering crystals | | Uses | 1,4-Dibromo-2,5-difluorobenzene has been used in the preparation of 1,2,4,5-tetrakis(phosphino)-3,6-difluorobenzenes and poly(2,5-difluoro-2?,5?-didodecyl-4,4?-biphenylylene. | | Uses | 1,4-Dibromo-2,5-difluorobenzene has been used in the preparation of:
- 1,2,4,5-tetrakis(phosphino)-3,6-difluorobenzenes
- poly(2,5-difluoro-2′,5′-didodecyl-4,4′-biphenylylene
|
| | 1,4-Dibromo-2,5-difluorobenzene Preparation Products And Raw materials |
|