| Company Name: |
Briti Scientific
|
| Tel: |
+91-8790384772 +91-8179784772 |
| Email: |
sales@britiscientific.com |
| Products Intro: |
Product Name:2,3,4,5-tetrahydro-6(4-chlorophenyl)-3(2H)-pyridazinone
CAS:1079-73-8
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Shanghai Rlavie Technology Co., Ltd.
|
| Tel: |
021-67759270 17717059219 |
| Email: |
sales@rlavie.com |
| Products Intro: |
Product Name:6-(4-chlorophenyl)-4,5-dihydro-3(2H)-pyridazinone
CAS:1079-73-8
Purity:98%min Package:100g;1kg;5kgs
|
| Company Name: |
Zhuhai Aobokai Biomedical Technology Co., Ltd.
|
| Tel: |
400-0628126 15697567703; |
| Email: |
sales-team@aobchem.com.cn |
| Products Intro: |
Product Name:6-(4-Chlorophenyl)-2,3,4,5-tetrahydro-3-pyridazinone
CAS:1079-73-8
Purity:>=95% Remarks:839350
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:6-(4-Chlorophenyl)-4,5-dihydropyridazin-3(2H)-one
CAS:1079-73-8
|
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
| Products Intro: |
Product Name:Compound Fr13155
CAS:1079-73-8
Package:5mg/RMB 297;1mg/RMB 135
|
|
| | 2,3,4,5-TETRAHYDRO-6(4-CHLOROPHENYL)-3(2H)-PYRIDAZINONE Basic information |
| Product Name: | 2,3,4,5-TETRAHYDRO-6(4-CHLOROPHENYL)-3(2H)-PYRIDAZINONE | | Synonyms: | TIMTEC-BB SBB003462;2,3,4,5-TETRAHYDRO-6(4-CHLOROPHENYL)-3(2H)-PYRIDAZINONE;6-(4-CHLOROPHENYL)-4,5-DIHYDRO-3(2H)-PYRIDAZINONE;6-(4-CHLOROPHENYL)-4,5-DIHYDROPYRIDAZIN-3(2H)-ONE;3-(4-chlorophenyl)-4,5-dihydro-1H-pyridazin-6-one;JRH-07003, 6-(4-Chlorophenyl)-4,5-dihydropyridazin-3(2H)-one, 97%;3(2H)-Pyridazinone, 6-(4-chlorophenyl)-4,5-dihydro-;6-(4-Chlorophenyl)-4,5-dihydropyridazin-3(2H)-one | | CAS: | 1079-73-8 | | MF: | C10H9ClN2O | | MW: | 208.64 | | EINECS: | | | Product Categories: | | | Mol File: | 1079-73-8.mol |  |
| | 2,3,4,5-TETRAHYDRO-6(4-CHLOROPHENYL)-3(2H)-PYRIDAZINONE Chemical Properties |
| Melting point | 178 °C | | density | 1.36±0.1 g/cm3(Predicted) | | pka | 13.52±0.40(Predicted) | | form | solid | | InChI | 1S/C10H9ClN2O/c11-8-3-1-7(2-4-8)9-5-6-10(14)13-12-9/h1-4H,5-6H2,(H,13,14) | | InChIKey | AZDWIMWFLAIPIR-UHFFFAOYSA-N | | SMILES | O=C1NN=C(CC1)C(C=C2)=CC=C2Cl |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2,3,4,5-TETRAHYDRO-6(4-CHLOROPHENYL)-3(2H)-PYRIDAZINONE Usage And Synthesis |
| Definition | ChEBI: 6-(4-Chlorophenyl)-2,3,4,5-tetrahydropyridazin-3-one is an organochlorine compound. | | Synthesis Reference(s) | Journal of the American Chemical Society, 75, p. 1117, 1953 DOI: 10.1021/ja01101a032 |
| | 2,3,4,5-TETRAHYDRO-6(4-CHLOROPHENYL)-3(2H)-PYRIDAZINONE Preparation Products And Raw materials |
|