|
|
| | 1-(BROMOMETHYL)-4-PHENOXYBENZENE Basic information |
| Product Name: | 1-(BROMOMETHYL)-4-PHENOXYBENZENE | | Synonyms: | 1-(BROMOMETHYL)-4-PHENOXYBENZENE;4-PHENYLOXYBENZYLBROMIDE;4-Phenoxybenzyl bromide 97%;4-Phenoxybenzyl bromide;Benzene, 1-(bromomethyl)-4-phenoxy-;1-broMethyl-4-phenoxybenzene;4-Phenoxybenzylbromide97%;JR-13603, 1-(Bromomethyl)-4-phenoxybenzene, 97% | | CAS: | 36881-42-2 | | MF: | C13H11BrO | | MW: | 263.13 | | EINECS: | 253-253-6 | | Product Categories: | pharmacetical | | Mol File: | 36881-42-2.mol |  |
| | 1-(BROMOMETHYL)-4-PHENOXYBENZENE Chemical Properties |
| Boiling point | 157-160 °C(Press: 6 Torr) | | density | 1.388±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Sensitive | Lachrymatory | | InChI | 1S/C13H11BrO/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h1-9H,10H2 | | InChIKey | CPIGBCFBFZSCQI-UHFFFAOYSA-N | | SMILES | BrCC1=CC=C(C=C1)OC2=CC=CC=C2 |
| Hazard Codes | C | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | HazardClass | 8 | | HS Code | 2909309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 1-(BROMOMETHYL)-4-PHENOXYBENZENE Usage And Synthesis |
| Uses | 1-(Bromomethyl)-4-phenoxybenzene is used in preparation of indole derivatives as matriptase 2 inhibitors useful for treating diseases. |
| | 1-(BROMOMETHYL)-4-PHENOXYBENZENE Preparation Products And Raw materials |
|