|
|
| | 3-(1-Piperazinyl)-1,2-benzisothiazole Basic information |
| | 3-(1-Piperazinyl)-1,2-benzisothiazole Chemical Properties |
| Melting point | 89.0 to 93.0 °C | | Boiling point | 320.2±35.0 °C(Predicted) | | density | 1.256 | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 8.52±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | BRN | 4253627 | | InChI | InChI=1S/C11H13N3S/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 | | InChIKey | KRDOFMHJLWKXIU-UHFFFAOYSA-N | | SMILES | S1C2=C(C=CC=C2)C(N2CCNCC2)=N1 | | LogP | 2.14 | | CAS DataBase Reference | 87691-87-0(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25-36/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 3-(1-Piperazinyl)-1,2-benzisothiazole Usage And Synthesis |
| Chemical Properties | 3-(1-Piperazinyl)-1,2-benzisothiazole is Yellow Solid | | Uses | 3-(1-Piperazinyl)-1,2-benzisothiazole is a reagent used to synthesize Ziprasidione | | Definition | ChEBI: ID11614 is a N-arylpiperazine. | | IC 50 | 5-HT1A Receptor: 190 nM (IC50); 5-HT2 Receptor: 110 nM (IC50) | | References | [1] Bioorganic and Medicinal Chemistry, 2014, vol. 22, # 23, p. 6552 - 6563 [2] Patent: CN108440520, 2018, A. Location in patent: Paragraph 0054; 0056; 0062; 0063 [3] Journal of Medicinal Chemistry, 1986, vol. 29, # 3, p. 359 - 369 [4] Patent: WO2010/38948, 2010, A2. Location in patent: Page/Page column 54-55 [5] Chemical and Pharmaceutical Bulletin, 1995, vol. 43, # 12, p. 2139 - 2151 |
| | 3-(1-Piperazinyl)-1,2-benzisothiazole Preparation Products And Raw materials |
|