| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Fluoro-4-(tributylstanny)lpyridine Basic information |
| Product Name: | 2-Fluoro-4-(tributylstanny)lpyridine | | Synonyms: | (2-Fluoropyridin-4-yl)tributylstannane;tributyl-(2-fluoropyridin-4-yl)stannane;Pyridine, 2-fluoro-4-(tributylstannyl)-;SKL1065;2-Fluoro-4-(tributylstannyl)pyridine - [F2402];2-Fluoro-4-(tributylstanny)lpyridine | | CAS: | 457061-31-3 | | MF: | C17H30FNSn | | MW: | 386.14 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | Mol File |  |
| | 2-Fluoro-4-(tributylstanny)lpyridine Chemical Properties |
| density | 1.187 g/mL at 25 °C | | refractive index | n20/D1.508 | | Fp | >110℃ | | form | liquid | | InChI | 1S/C5H3FN.3C4H9.Sn/c6-5-3-1-2-4-7-5;3*1-3-4-2;/h2-4H;3*1,3-4H2,2H3; | | InChIKey | YGKPEWRENKJYRP-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccnc(F)c1 |
| Hazard Codes | T | | RIDADR | UN 2788 6.1 / PGIII | | WGK Germany | 3 | | Hazard Note | Toxic | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 2-Fluoro-4-(tributylstanny)lpyridine Usage And Synthesis |
| | 2-Fluoro-4-(tributylstanny)lpyridine Preparation Products And Raw materials |
|