|
|
| | AKOS BBS-00007039 Basic information |
| Product Name: | AKOS BBS-00007039 | | Synonyms: | AKOS BBS-00007039;IFLAB-BB F2130-0031;3-(4-Hydroxyphenyl)-1H-pyrazole-5-carboxylic acid;1H-Pyrazole-5-carboxylicacid,3-(4-hydroxyphenyl)-;1H-Pyrazole-3-carboxylic acid, 5-(4-hydroxyphenyl)- | | CAS: | 1093649-88-7 | | MF: | C10H8N2O3 | | MW: | 204.18 | | EINECS: | | | Product Categories: | | | Mol File: | 1093649-88-7.mol |  |
| | AKOS BBS-00007039 Chemical Properties |
| Boiling point | 555.8±40.0 °C(Predicted) | | density | 1.487±0.06 g/cm3(Predicted) | | pka | 3.94±0.10(Predicted) | | form | solid | | InChI | 1S/C10H8N2O3/c13-7-3-1-6(2-4-7)8-5-9(10(14)15)12-11-8/h1-5,13H,(H,11,12)(H,14,15) | | InChIKey | YAYDMJNTBGROTD-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC(C(C=C2)=CC=C2O)=NN1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | AKOS BBS-00007039 Usage And Synthesis |
| | AKOS BBS-00007039 Preparation Products And Raw materials |
|