Benzenamine, 5-bromo-2,3-dichloro- manufacturers
|
| | Benzenamine, 5-bromo-2,3-dichloro- Basic information | | Uses |
| | Benzenamine, 5-bromo-2,3-dichloro- Chemical Properties |
| Boiling point | 296.0±35.0 °C(Predicted) | | density | 1.827±0.06 g/cm3(Predicted) | | pka | 0.52±0.10(Predicted) | | InChI | InChI=1S/C6H4BrCl2N/c7-3-1-4(8)6(9)5(10)2-3/h1-2H,10H2 | | InChIKey | YQKHCZHEROVCCA-UHFFFAOYSA-N | | SMILES | C1(N)=CC(Br)=CC(Cl)=C1Cl |
| | Benzenamine, 5-bromo-2,3-dichloro- Usage And Synthesis |
| Uses | 5-Bromo-2,3-dichloroaniline is an aniline derivative used in pharmaceutical synthesis and scientific research. |
| | Benzenamine, 5-bromo-2,3-dichloro- Preparation Products And Raw materials |
|