|
|
| | 3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE Basic information |
| Product Name: | 3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE | | Synonyms: | 3',4'-Difluoro-biphenyl-2-amine;3',4'-difluoro-2-aminebiphenyl;3,4-trifloro-2-aminebiphenyl;3,4-difluoro-2'-aminobiphenyl;[1,1'-Biphenyl]-2-amine, 3',4'-difluoro-;3',4'-difluoro[1,1'-biphenyl]-2-amine;3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE | | CAS: | 873056-62-3 | | MF: | C12H9F2N | | MW: | 205.2 | | EINECS: | 239-307-1 | | Product Categories: | | | Mol File: | Mol File | ![3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE Structure](StructureFile/ChemBookStructure21/GIF/CB3827280.gif) |
| | 3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE Chemical Properties |
| Boiling point | 306.8±27.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.71±0.10(Predicted) | | InChI | InChI=1S/C12H9F2N/c13-10-6-5-8(7-11(10)14)9-3-1-2-4-12(9)15/h1-7H,15H2 | | InChIKey | HFHHGKVFBPGNTR-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(F)C(F)=C2)=CC=CC=C1N |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE Usage And Synthesis |
| | 3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE Preparation Products And Raw materials |
|