| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2?4?Dihydroxy-4-prenyloxychalcone >=85% (LC/MS-UV) Basic information |
| | 2?4?Dihydroxy-4-prenyloxychalcone >=85% (LC/MS-UV) Chemical Properties |
| Melting point | 155-158 °C | | Boiling point | 541.1±42.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: 1mg/mL | | pka | 7.48±0.35(Predicted) | | form | solid | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | 1S/C20H20O4/c1-14(2)11-12-24-17-7-3-15(4-8-17)5-10-19(22)18-9-6-16(21)13-20(18)23/h3-11,13,21,23H,12H2,1-2H3/b10-5+ | | InChIKey | VVSZRCIUFBADJQ-BJMVGYQFSA-N | | SMILES | O=C(C1=C(C=C(C=C1)O)O)/C=C/C2=CC=C(OCC=C(C)C)C=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2?4?Dihydroxy-4-prenyloxychalcone >=85% (LC/MS-UV) Usage And Synthesis |
| Uses | metabolomics vitamins, nutraceuticals, and natural products |
| | 2?4?Dihydroxy-4-prenyloxychalcone >=85% (LC/MS-UV) Preparation Products And Raw materials |
|