|
|
| | 4-FLUOROQUINOLINE Basic information |
| | 4-FLUOROQUINOLINE Chemical Properties |
| Melting point | 180-195 °C | | Boiling point | 119 °C(Press: 30 Torr) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 3.87±0.13(Predicted) | | InChI | InChI=1S/C9H6FN/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H | | InChIKey | IZCUJTLKJPQFSY-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(F)=CC=1 |
| | 4-FLUOROQUINOLINE Usage And Synthesis |
| Uses | A fluorinated quinilone that in the presence of microsomal activation exhibits some mutagenic activity in Salmonella typhimurium TA100 but showed no significant effect on unscheduled DNA synthesis (UDS) in rat hepatocytes compared to other fluoroquinones. |
| | 4-FLUOROQUINOLINE Preparation Products And Raw materials |
|