|
|
| | (1S,2R)-2-Amino-1,2-diphenylethanol Basic information | | Reaction |
| Product Name: | (1S,2R)-2-Amino-1,2-diphenylethanol | | Synonyms: | (1S,2R)-(-)-2-AMINO-1,2-DIPHENYLETHANOL;(1S,2R)-(+)-2-AMINO-1,2-DIPHENYLETHANOL;(1S,2R)-2-AMINO-1,2-DIPHENYLETHANOL;(1S,2R)-(+)-DIPHENYL-2-AMINOETHANOL;(1S,2R)-2-Amino-1,2-diphenylethanol,98%;(1S,2R)-(+)-2-Amino-1,2-diphenylethanol ,98% [ee:99%];(1R,2S)-1,2-Diphenyl-1-amino-2-hydroxyethane;(1S,2R)-2-Amino-1,2- | | CAS: | 23364-44-5 | | MF: | C14H15NO | | MW: | 213.28 | | EINECS: | 628-513-0 | | Product Categories: | Organic Building Blocks;Chiral Compound;Benzene derivatives;Amino Alcohols;Chiral Building Blocks;chiral;Chiral reagent;Amino Alcohols (Chiral);Chiral Building Blocks;for Resolution of Acids;Optical Resolution;Synthetic Organic Chemistry;Amino Alcohols & Deriv.;CHIRAL CHEMICALS;Chiral chemicals | | Mol File: | 23364-44-5.mol |  |
| | (1S,2R)-2-Amino-1,2-diphenylethanol Chemical Properties |
| Melting point | 142-144 °C(lit.) | | alpha | 7 º (c=0.6, EtOH) | | Boiling point | 374.3±37.0 °C(Predicted) | | density | 1.148±0.06 g/cm3(Predicted) | | refractive index | 7 ° (C=0.6, EtOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | very faint turbidity in Methanol | | pka | 11.70±0.45(Predicted) | | form | Crystalline Powder | | color | White to beige | | Optical Rotation | [α]25/D +7.0°, c = 0.6 in ethanol | | BRN | 1212828 | | InChI | InChI=1/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14+/s3 | | InChIKey | GEJJWYZZKKKSEV-KGLIPLIRSA-N | | SMILES | [C@H](C1C=CC=CC=1)(N)[C@H](C1C=CC=CC=1)O |&1:0,8,r| | | CAS DataBase Reference | 23364-44-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 9 | | HS Code | 29221990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1S,2R)-2-Amino-1,2-diphenylethanol Usage And Synthesis |
| Reaction |
- Ligand used to make chiral oxaborolidines for the enantioselective alkynylation of aldehydes
- Ligand used in organoindium reagents for asymmetric Barbier-type allylations
- Ligand used in organoindium reagents for asymmetric Barbier-type propargylations
| | Chemical Properties | white to light yellow crystal powde | | Uses | (1S,2R)-(+)-2-Amino-1,2-diphenylethanol can be used:
- To prepare vanadium(V) Schiff base complexes, which are used as catalysts in the oxidation of sulfides and olefins.
- To prepare chiral selectors, which are immobilized on aminated silica gel, applicable as chiral stationary phase in HPLC.
- To immobilize on the frame of α-zirconium phosphate to yield layered zirconium phosphonates, which are used in the heterogeneous catalysis.
- As a chiral auxiliary in the preparation of homopropargylic alcohols from aliphatic and aromatic aldehydes.
|
| | (1S,2R)-2-Amino-1,2-diphenylethanol Preparation Products And Raw materials |
|