Related articles - What is 3-amino-2-naphthoic acid?
- 3-Amino-2-naphthoic acid, is an unnatural aromatic amino acid, that can be used for the manufacture of more complex compounds.....
- Feb 12，2020
|
| | 3-Amino-2-naphthoic acid Basic information | | Uses |
| | 3-Amino-2-naphthoic acid Chemical Properties |
| Melting point | 212-215 °C (dec.) (lit.) | | Boiling point | 321.94°C (rough estimate) | | density | 1.1963 (rough estimate) | | refractive index | 1.4900 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.20±0.30(Predicted) | | form | Powder | | color | Yellow-green to green | | Water Solubility | Soluble in alcohol and ether. Insoluble in water. | | Merck | 14,452 | | BRN | 744099 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H9NO2/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6H,12H2,(H,13,14) | | InChIKey | XFXOLBNQYFRSLQ-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC(N)=C1C(O)=O | | CAS DataBase Reference | 5959-52-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 3-amino- (5959-52-4) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | QL1400000 | | TSCA | TSCA listed | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Amino-2-naphthoic acid Usage And Synthesis |
| Uses | 3-Amino-2-naphthoic acid, is an unnatural aromatic amino acid, that can be used for the manufacture of more complex compounds. It can be utilized for the synthesis of novel acronycine/duocarmycin hybrid natural product.
| | Chemical Properties | yellow-green to green powder | | Uses | 3-Amino-2-naphthoic acid is a dyes analytical reagent which is used as an intermediate for organic synthesis. | | Definition | ChEBI: 3-amino-2-naphthoic acid is a naphthoic acid. | | reaction suitability | reaction type: solution phase peptide synthesis | | Purification Methods | Crystallise the naphthoic acid from aqueous EtOH. [Beilstein 14 III 1341.] |
| | 3-Amino-2-naphthoic acid Preparation Products And Raw materials |
|