Ethyl 2-amino-4-phenyl-5-thiazolecarboxylate manufacturers
|
| | Ethyl 2-amino-4-phenyl-5-thiazolecarboxylate Basic information |
| | Ethyl 2-amino-4-phenyl-5-thiazolecarboxylate Chemical Properties |
| Melting point | 169-173 °C (lit.) | | Boiling point | 449.1±33.0 °C(Predicted) | | density | 1.2701 (rough estimate) | | refractive index | 1.5950 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Dimethylformamide | | form | Crystalline Powder | | pka | 2.51±0.10(Predicted) | | color | Light brown | | BRN | 222259 | | InChI | 1S/C12H12N2O2S/c1-2-16-11(15)10-9(14-12(13)17-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,13,14) | | InChIKey | OZMXFXOHCUEEPD-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1sc(N)nc1-c2ccccc2 | | CAS DataBase Reference | 64399-23-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29341000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | Ethyl 2-amino-4-phenyl-5-thiazolecarboxylate Usage And Synthesis |
| Chemical Properties | light brown crystalline powder |
| | Ethyl 2-amino-4-phenyl-5-thiazolecarboxylate Preparation Products And Raw materials |
|