|
|
| | Nitroxylol Basic information |
| | Nitroxylol Chemical Properties |
| Melting point | 72-74 °C(lit.) | | Boiling point | 273 °C739 mm Hg(lit.) | | density | 1.1446 (estimate) | | refractive index | 1.5359 (estimate) | | Fp | 273°C | | form | powder to crystal | | color | Light orange to Yellow to Green | | Water Solubility | Insoluble in water. | | BRN | 1936130 | | InChI | 1S/C8H9NO2/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3 | | InChIKey | BYFNZOKBMZKTSC-UHFFFAOYSA-N | | SMILES | Cc1cc(C)cc(c1)[N+]([O-])=O | | CAS DataBase Reference | 99-12-7(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Nitro-m-xylene(99-12-7) | | EPA Substance Registry System | 5-Nitro-m-xylene (99-12-7) |
| Hazard Codes | T,Xn | | Risk Statements | 23/24/25-33-20/21/22-36/37/38 | | Safety Statements | 45-36/37-36/37/39-26-13 | | RIDADR | UN 3447 6.1/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
STOT RE 2 |
| | Nitroxylol Usage And Synthesis |
| Chemical Properties | yellow to yellow-orange crystals or chunks | | Uses | 5-Nitro-m-xylene was used in aerobic oxidation of aromatic anilines to aromatic azo compounds using gold nanoparticles supported on TiO2 as a catalyst. | | General Description | Needles or yellow crystalline solid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | Nitroxylol is incompatible with strong oxidizing agents and strong bases. | | Fire Hazard | Flash point data for Nitroxylol is not available, but Nitroxylol is probably combustible. |
| | Nitroxylol Preparation Products And Raw materials |
|