| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | (E)-3-Methylpent-2-en-4-yn-1-ol Basic information |
| Product Name: | (E)-3-Methylpent-2-en-4-yn-1-ol | | Synonyms: | trans-3-Methyl-2-penten-4-ynol;Enynic Alcohol;Trans-3-Methyl-2-Penten-4-Yn-1-Ol;trans-3-Methyl-2-penten-4-yn-1-ol, GC 90%;trans-3-Methyl-2-pentene-4-yn-1-ol;(E)-3-Methyl-2-penten-4-yn-1-ol;(E)-3-Methylpent-2-en-4-yn-1-ol;(E)-3-methyl-1-pent-2-en-4-ynol | | CAS: | 6153-06-6 | | MF: | C6H8O | | MW: | 96.13 | | EINECS: | 228-169-8 | | Product Categories: | | | Mol File: | 6153-06-6.mol |  |
| | (E)-3-Methylpent-2-en-4-yn-1-ol Chemical Properties |
| Boiling point | 171°C | | density | 0.940 | | refractive index | 1.4445-1.4465 | | Fp | 65°C | | pka | 13.80±0.10(Predicted) | | InChI | InChI=1S/C6H8O/c1-3-6(2)4-5-7/h1,4,7H,5H2,2H3/b6-4+ | | InChIKey | ZSJHASYJQIRSLE-GQCTYLIASA-N | | SMILES | C(O)/C=C(\C)/C#C |
| | (E)-3-Methylpent-2-en-4-yn-1-ol Usage And Synthesis |
| Uses | (E)-3-Methylpent-2-en-4-yn-1-ol is a terminal alkyne and a useful building block for organic synthesis. |
| | (E)-3-Methylpent-2-en-4-yn-1-ol Preparation Products And Raw materials |
|