| Company Name: |
Chengdu Pukang Biotechnology Co., Ltd
|
| Tel: |
156 18217049878 |
| Email: |
cassie.gao@pu-kang.com |
| Products Intro: |
Product Name:Fmoc-PEG12-TFP ester
CAS:2247993-77-5
Purity:95%,HPLC Package:10g/;50g/;500g/
|
| Company Name: |
Chengdu Hanwei Biotechnology Co., Ltd
|
| Tel: |
17360178904 18217049878 |
| Email: |
zengzongwen@pegtide.com |
| Products Intro: |
Product Name:Fmoc-NH-PEG4-PFP
CAS:2247993-77-5
Purity:>=98% Package:250mg;1g;5g;10g;25g
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Fmoc-N-amido-dPEG ®4-TFP ester
CAS:2247993-77-5
|
|
| | 5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester Basic information |
| Product Name: | 5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester | | Synonyms: | Fmoc-N-amido-dPEG??-TFP ester;5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester;Fmoc-PEG12-TFP ester;Fmoc-NH-PEG4-PFP;Fmoc-N-amido-dPEG ?4-TFP ester | | CAS: | 2247993-77-5 | | MF: | C32H33F4NO8 | | MW: | 635.6 | | EINECS: | | | Product Categories: | | | Mol File: | 2247993-77-5.mol |  |
| | 5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester Chemical Properties |
| Boiling point | 718.8±60.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 11.60±0.46(Predicted) | | form | solid or viscous liquid | | InChIKey | WHOLLFBFIYSCEW-UHFFFAOYSA-N | | SMILES | O=C(NCCOCCOCCOCCOCCC(OC1=C(F)C(F)=CC(F)=C1F)=O)OCC2C(C=CC=C3)=C3C4=C2C=CC=C4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester Usage And Synthesis |
| reaction suitability | reaction type: Pegylations
reagent type: cross-linking reagent |
| | 5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester Preparation Products And Raw materials |
|
|
Tag:5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(9H-fluoren-9-ylmethyl) 17-(2,3,5,6-tetrafluorophenyl) ester(2247993-77-5)
Related Product Information
|