methanedisulphonyl dichloride manufacturers
- methanedisulphonyl dichloride
-
- $101.00 / 1KG
-
2025-09-25
- CAS:5799-68-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | methanedisulphonyl dichloride Basic information |
| Product Name: | methanedisulphonyl dichloride | | Synonyms: | methanedisulphonyl dichloride;methanedisulfonyl chloride;methanedisulfonyl dichloride;methylenedisulfonyl dichloride;Methanedisulfonic acid dichloride;Methylenedisulfonyl Dichloride
Methanedisulfonyl Chloride;MethanedisulfonylDichloride>;Bis(chlorosulfonyl)methane | | CAS: | 5799-68-8 | | MF: | CH2Cl2O4S2 | | MW: | 213.06 | | EINECS: | 227-350-9 | | Product Categories: | | | Mol File: | 5799-68-8.mol |  |
| | methanedisulphonyl dichloride Chemical Properties |
| Boiling point | 138 °C / 15mmHg | | density | 1.83 | | refractive index | 1.5140-1.5180 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Red to Green | | InChI | InChI=1S/CH2Cl2O4S2/c2-8(4,5)1-9(3,6)7/h1H2 | | InChIKey | DKZQZHQHDMVGHE-UHFFFAOYSA-N | | SMILES | C(S(Cl)(=O)=O)S(Cl)(=O)=O |
| RIDADR | 3265 | | HS Code | 2904.10.5000 | | HazardClass | 8 | | PackingGroup | II |
| | methanedisulphonyl dichloride Usage And Synthesis |
| | methanedisulphonyl dichloride Preparation Products And Raw materials |
|