|
|
| | zinc O,O,O',O'-tetrabutyl bis(phosphorodithioate) Basic information |
| Product Name: | zinc O,O,O',O'-tetrabutyl bis(phosphorodithioate) | | Synonyms: | zinc O,O,O',O'-tetrabutyl bis(phosphorodithioate);Zinc, bis(O,O-dibutyl phosphorodithioato-.kappa.S,.kappa.S)-, (T-4)-;O,O-Dibutylphosphorodithioic acid zinc salt;Zinc, bis(O,O-dibutyl phosphorodithioato-S,S')-, (T-4)-;zinc dibutyl dithiophosphate;Bis(dithiophosphoric acid dibutyl) zinc salt;Bis[dibutoxyphosphinothioylthio]zinc;Bis(o,o-dibutyl phosphorodithioato-S,S')zinc (T-4) | | CAS: | 6990-43-8 | | MF: | C8H19O2PS2.1/2Zn | | MW: | 548.06 | | EINECS: | 230-257-6 | | Product Categories: | Organometallics | | Mol File: | 6990-43-8.mol |  |
| | zinc O,O,O',O'-tetrabutyl bis(phosphorodithioate) Chemical Properties |
| Melting point | 36.8 °C | | vapor pressure | 0Pa at 25℃ | | Fp | 195°C (383°F) | | solubility | 8090.2g/L in organic solvents at 20 ℃ | | Specific Gravity | 1.26 | | Water Solubility | 1.7g/L at 20℃ | | Hydrolytic Sensitivity | 0: forms stable aqueous solutions | | InChI | InChI=1S/2C8H19O2PS2.Zn/c2*1-3-5-7-9-11(12,13)10-8-6-4-2;/h2*3-8H2,1-2H3,(H,12,13);/q;;+2/p-2 | | InChIKey | MECFLMNXIXDIOF-UHFFFAOYSA-L | | SMILES | [Zn+2].P(=S)([S-])(OCCCC)OCCCC.P(=S)([S-])(OCCCC)OCCCC | | LogP | 2.5 at 20℃ | | EPA Substance Registry System | Zinc, bis(O,O-dibutyl phosphorodithioato-.kappa.S,.kappa.S')-, (T-4)- (6990-43-8) |
| | zinc O,O,O',O'-tetrabutyl bis(phosphorodithioate) Usage And Synthesis |
| Hazard | Moderately toxic by ingestion. A mild skin
and severe eye irritant. |
| | zinc O,O,O',O'-tetrabutyl bis(phosphorodithioate) Preparation Products And Raw materials |
|