2-tert-butyl-1,4-dimethoxybenzene manufacturers
- Vetimoss
-
- $30.00 / 1KG
-
2025-06-20
- CAS:21112-37-8
- Min. Order: 1KG
- Purity: 0.99
- Supply Ability: 20TONS
|
| | 2-tert-butyl-1,4-dimethoxybenzene Basic information |
| Product Name: | 2-tert-butyl-1,4-dimethoxybenzene | | Synonyms: | 2-tert-butyl-1,4-dimethoxybenzene;1,4-Dimethoxy-2-tert-butylbenzene;Benzene, 2-(1,1-dimethylethyl)-1,4-dimethoxy-;3-t-Butyl-4-methoxyphenol methyl derivative;1,4-DIMETHOXY-TERT-BUTYLBENZENE;2-tert.-Butyl-1,4-dimethoxybenzol;Benzene, 2-tert-butyl-1,4-dimethoxy-;Dimethoxy-1,4-tert-butyl-2-benzene | | CAS: | 21112-37-8 | | MF: | C12H18O2 | | MW: | 194.27 | | EINECS: | 244-216-5 | | Product Categories: | | | Mol File: | 21112-37-8.mol |  |
| | 2-tert-butyl-1,4-dimethoxybenzene Chemical Properties |
| Melting point | 70-70.5 °C | | Boiling point | 117-118 °C(Press: 12 Torr) | | density | 0.9978 g/cm3(Temp: 15 °C) | | vapor pressure | 20Pa at 20℃ | | Odor | at 100.00 %. rich woody vetiver forest | | Odor Type | woody | | Water Solubility | 19.17mg/L at 20℃ | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C12H18O2/c1-12(2,3)10-8-9(13-4)6-7-11(10)14-5/h6-8H,1-5H3 | | InChIKey | ALVJDUNBMKMTDC-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(OC)C=C1C(C)(C)C | | LogP | 4.4 | | EPA Substance Registry System | 2-tert-Butyl-1,4-dimethoxybenzene (21112-37-8) |
| | 2-tert-butyl-1,4-dimethoxybenzene Usage And Synthesis |
| | 2-tert-butyl-1,4-dimethoxybenzene Preparation Products And Raw materials |
|