|
|
| | Propylene glycol dicaprylate/dicaproate Basic information |
| Product Name: | Propylene glycol dicaprylate/dicaproate | | Synonyms: | Decansure, gemischte Diester mit Octansure und Propylenglykol;Caprylic, capric acid, propylene glycol diester;Decanoic acid, mixed diesters with octanoic acid and propylene glycol;PROPYLENEGLYCOLDIDECANOATE-DIOCTANOATE;Xin capric acid propylene glycol ester;WAGLIOL (PROPYLENE GLYCOL DICAPRYLATE;Propylene Glycol Dicaprylate/Dicaprate (1 mL);Caprylic/Capric | | CAS: | 68583-51-7 | | MF: | C21H44O6 | | MW: | 392.58 | | EINECS: | 271-516-3 | | Product Categories: | | | Mol File: | 68583-51-7.mol |  |
| | Propylene glycol dicaprylate/dicaproate Chemical Properties |
| Odor | at 100.00?%. bland | | Major Application | pharmaceutical (small molecule) | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C10H20O2.C8H16O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-3(5)2-4/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);3-5H,2H2,1H3 | | InChIKey | YZWQUQVFVLJWCS-UHFFFAOYSA-N | | SMILES | C(O)(C)CO.C(CC(=O)O)CCCCC.C(CCC(=O)O)CCCCCC | | LogP | 3.965 (est) | | EPA Substance Registry System | Propylene glycol caprylic acid capric acid mixed diesters (68583-51-7) |
| WGK Germany | WGK 1 | | TSCA | TSCA listed | | HS Code | 3824994100 | | Storage Class | 10 - Combustible liquids |
| | Propylene glycol dicaprylate/dicaproate Usage And Synthesis |
| Uses | pharmaceutical (small molecule) | | General Description |
Propylene glycol dicaprylate/dicaproate is a clear to pale yellow liquid that may be used as a solvent, lubricant and emollient in cosmetics and personal care products.
| | Flammability and Explosibility | Not classified |
| | Propylene glycol dicaprylate/dicaproate Preparation Products And Raw materials |
|