| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate) Basic information |
| Product Name: | zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate) | | Synonyms: | bis(2-ethylhexoxy)-sulfanylidene-sulfido-λ^{5}-phosphane;zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate);Zinc, bisO,O-bis(2-ethylhexyl) phosphorodithioato-.kappa.S,.kappa.S-, (T-4)-;ZINCBISOODI2ETHYLHEXYLDITHIOPHOSPHATE;Phosphorodithioic acid, O,O-di-2-ethylhexyl ester, zinc salt;(T-4)-BIS(O,O-BIS(2-ETHYLHEXYL)PHOSPHORODITHIOATO-S,S'')ZINC;Zinc, bis[O,O-bis(2-ethylhexyl) phosphorodithioato-S,S']-, (T-4)-;zinc bis(2-ethylhexyl)dithiophosphate | | CAS: | 4259-15-8 | | MF: | C32H72O4P2S4Zn | | MW: | 776.49 | | EINECS: | 224-235-5 | | Product Categories: | Organometallics | | Mol File: | 4259-15-8.mol | ![zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate) Structure](CAS/20180808/GIF/4259-15-8.gif) |
| | zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate) Chemical Properties |
| vapor pressure | 0-0.024Pa at 25-70℃ | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Viscous | | InChI | InChI=1S/2C16H35O2PS2.Zn/c2*1-5-9-11-15(7-3)13-17-19(20,21)18-14-16(8-4)12-10-6-2;/h2*15-16H,5-14H2,1-4H3,(H,20,21);/q;;-2/p+2 | | InChIKey | YVNSKXQECPVKRT-UHFFFAOYSA-P | | SMILES | O(P1(=S[Zn+2]2(S=P(OCC(CC)CCCC)(OCC(CC)CCCC)[SH-]2)[SH-]1)OCC(CC)CCCC)CC(CC)CCCC | | LogP | 3.59 at 22℃ and pH5 | | Surface tension | 63.7mN/m at 1.25g/L and 21℃ | | EPA Substance Registry System | Zinc, bis[O,O-bis(2-ethylhexyl) phosphorodithioato-.kappa.S,.kappa.S']-, (T-4)- (4259-15-8) |
| | zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate) Usage And Synthesis |
| Uses | Zinc Bis(2-Ethylhexyl) Phosphorodithioate is an analytical standard with antioxidant properties. |
| | zinc bis[O,O-bis(2-ethylhexyl)] bis(dithiophosphate) Preparation Products And Raw materials |
|