| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Mesterolone impurity A
CAS:604-26-2
|
|
| | 17beta-hydroxy-1alpha-methylandrost-4-ene-3-one Basic information |
| Product Name: | 17beta-hydroxy-1alpha-methylandrost-4-ene-3-one | | Synonyms: | 17beta-hydroxy-1alpha-methylandrost-4-ene-3-one;17β-Hydroxy-1α-methylandrost-4-en-3-one;1α-Methyltestosterone;(1S,8R,9S,10R,13S,14S,17S)-17-hydroxy-1,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;(1α,17β)-17-Hydroxy-1-methylandrost-4-en-3-one;Mesterolone impurity A CRS;Androst-4-en-3-one, 17-hydroxy-1-methyl-, (1α,17β)-;Mesteralone EP Impurity A | | CAS: | 604-26-2 | | MF: | C20H30O2 | | MW: | 302.45 | | EINECS: | 210-063-8 | | Product Categories: | | | Mol File: | 604-26-2.mol |  |
| | 17beta-hydroxy-1alpha-methylandrost-4-ene-3-one Chemical Properties |
| Melting point | 190-191 °C | | Boiling point | 438.9±45.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | storage temp. | 2-8°C | | pka | 15.06±0.70(Predicted) | | Water Solubility | 90mg/L at 25℃ | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C20H30O2/c1-12-10-14(21)11-13-4-5-15-16-6-7-18(22)19(16,2)9-8-17(15)20(12,13)3/h11-12,15-18,22H,4-10H2,1-3H3/t12-,15-,16-,17-,18-,19-,20-/m0/s1 | | InChIKey | KROXBRXHRBCDNO-IFMMWYRXSA-N | | SMILES | O[C@@H]1[C@@]2([C@H]([C@H]3[C@@H]([C@]4([C@H](CC(=O)C=C4CC3)C)C)CC2)CC1)C | | LogP | 2.92 at 25℃ |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
Repr. 2 |
| | 17beta-hydroxy-1alpha-methylandrost-4-ene-3-one Usage And Synthesis |
| Uses | Mesterolone impurity A EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| | 17beta-hydroxy-1alpha-methylandrost-4-ene-3-one Preparation Products And Raw materials |
|