sodium N-(6-chloropyrazinyl)sulphanilamidate manufacturers
- Sulfaclozine sodium
-
-
2026-03-27
- CAS:23307-72-4
- Min. Order: 1KG
- Purity: 99% HPLC
- Supply Ability: 10 Tons
|
| | sodium N-(6-chloropyrazinyl)sulphanilamidate Basic information |
| Product Name: | sodium N-(6-chloropyrazinyl)sulphanilamidate | | Synonyms: | sodium N-(6-chloropyrazinyl)sulphanilamidate;4-Amino-N-(6-chloro-2-pyrazinyl)benzenesulfonamide sodium salt;Sodium ((4-aminophenyl)sulfonyl)(6-chloropyrazin-2-yl)amide;Sulfaclozine (sodium salt);C16990045 SulfachloropyrazinEsodium;Sulfaclozine (sodium salt),Reagent;Sulfachloropyrazine sodium 100 μg/mL in Acetonitrile;Sulfaclozine sodium monohydrate | | CAS: | 23307-72-4 | | MF: | C10H10ClN4NaO2S | | MW: | 308.72 | | EINECS: | 245-571-9 | | Product Categories: | | | Mol File: | 23307-72-4.mol |  |
| | sodium N-(6-chloropyrazinyl)sulphanilamidate Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMF: 1 mg/ml; DMSO: 1 mg/ml; PBS (pH 7.2): 1 mg/ml | | form | Solid | | color | Light yellow to yellow | | Major Application | clinical testing | | InChI | 1S/C10H8ClN4O2S.Na/c11-9-5-13-6-10(14-9)15-18(16,17)8-3-1-7(12)2-4-8;/h1-6H,12H2;/q-1;+1 | | InChIKey | NIUFFODHMKLSCH-UHFFFAOYSA-N | | SMILES | Nc1ccc(cc1)S(=O)(=O)N([Na])c2cncc(Cl)n2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | sodium N-(6-chloropyrazinyl)sulphanilamidate Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | sodium N-(6-chloropyrazinyl)sulphanilamidate Preparation Products And Raw materials |
|