| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | potassium phenyl sulphate Basic information |
| Product Name: | potassium phenyl sulphate | | Synonyms: | potassium phenyl sulphate;Sulfuric acid phenyl=potassium salt;Sulfuric acid=phenyl=potassium salt;Sulfuric acid, monophenyl ester, potassium salt (1:1);Sulfuric Acid Phenyl Ester Potassium Salt | | CAS: | 1733-88-6 | | MF: | C6H7KO4S | | MW: | 213.27 | | EINECS: | 217-071-0 | | Product Categories: | | | Mol File: | 1733-88-6.mol |  |
| | potassium phenyl sulphate Chemical Properties |
| Melting point | 160°C(lit.) | | storage temp. | 2-8°C | | solubility | water: soluble | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | λmax | 262nm(H2O)(lit.) | | InChI | 1S/C6H6O4S.K/c7-11(8,9)10-6-4-2-1-3-5-6;/h1-5H,(H,7,8,9);/q;+1/p-1 | | InChIKey | NOUFXYHWAWIDNT-UHFFFAOYSA-M | | SMILES | [K+].[S](=O)(=O)([O-])Oc1ccccc1 |
| WGK Germany | WGK 3 | | RTECS | WT1180000 | | HS Code | 2920.90.2000 | | Storage Class | 11 - Combustible Solids |
| | potassium phenyl sulphate Usage And Synthesis |
| Uses | Metabolomics research
Microbiome research |
| | potassium phenyl sulphate Preparation Products And Raw materials |
|