| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | tributyl prop-1-ene-1,2,3-tricarboxylate Basic information |
| Product Name: | tributyl prop-1-ene-1,2,3-tricarboxylate | | Synonyms: | tributyl prop-1-ene-1,2,3-tricarboxylate;1-Propene-1,2,3-tricarboxylic acid tributyl ester;tributyl 1-propen-1,2,3-tricarboxylate;Tributyl Acetylcitrate EP Impurity B;Tributyl (E)-Propene-1,2,3-tricarbo;1-Propene-1,2,3-tricarboxylic acid, 1,2,3-tributyl ester;Tributyl prop-1-ene-1,2,3-tricarboxylate (mixture of E and Z);Tributyl Acetylcitrate Impurity B as (E)-Isomer | | CAS: | 7568-58-3 | | MF: | C18H30O6 | | MW: | 342.43 | | EINECS: | 2314686 | | Product Categories: | | | Mol File: | 7568-58-3.mol |  |
| | tributyl prop-1-ene-1,2,3-tricarboxylate Chemical Properties |
| Boiling point | 121 °C(Press: 2 Torr) | | density | 1.039±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C18H30O6/c1-4-7-10-22-16(19)13-15(18(21)24-12-9-6-3)14-17(20)23-11-8-5-2/h13H,4-12,14H2,1-3H3 | | InChIKey | BANLNYYTSYHBAP-UHFFFAOYSA-N | | SMILES | C(C(OCCCC)=O)=C(C(OCCCC)=O)CC(OCCCC)=O |
| | tributyl prop-1-ene-1,2,3-tricarboxylate Usage And Synthesis |
| Uses | Tributyl Aconitate is a bio based plasticizer used in flexible PVC products. |
| | tributyl prop-1-ene-1,2,3-tricarboxylate Preparation Products And Raw materials |
|